C18H29N3 — CID 79736616
1-N-[[1-(dimethylamino)cyclohexyl]methyl]-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79736616) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-N-[[1-(dimethylamino)cyclohexyl]methyl]-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-[[1-(dimethylamino)cyclohexyl]methyl]-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79736616 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 1-N-[[1-(dimethylamino)cyclohexyl]methyl]-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | CN(C)C1(CNC2CCc3cc(N)ccc32)CCCCC1 |
| InChI | InChI=1S/C18H29N3/c1-21(2)18(10-4-3-5-11-18)13-20-17-9-6-14-12-15(19)7-8-16(14)17/h7-8,12,17,20H,3-6,9-11,13,19H2,1-2H3 |
| InChIKey | KHXLLYLRBALLHB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|