C16H16BrNO3 — CID 79737466
N-(4-bromo-2,6-dimethylphenyl)-3-hydroxy-4-methoxybenzamide (PubChem CID 79737466) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-3-hydroxy-4-methoxybenzamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-3-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 79737466 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-3-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(C)cc(Br)cc2C)cc1O |
| InChI | InChI=1S/C16H16BrNO3/c1-9-6-12(17)7-10(2)15(9)18-16(20)11-4-5-14(21-3)13(19)8-11/h4-8,19H,1-3H3,(H,18,20) |
| InChIKey | LIBWOTRTDPMAIA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |