C18H28N2 — CID 79737789
N-propyl-3-(5,6,7,8-tetrahydroquinolin-8-yl)cyclohexan-1-amine (PubChem CID 79737789) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-propyl-3-(5,6,7,8-tetrahydroquinolin-8-yl)cyclohexan-1-amine.
| Compound Name | N-propyl-3-(5,6,7,8-tetrahydroquinolin-8-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 79737789 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-propyl-3-(5,6,7,8-tetrahydroquinolin-8-yl)cyclohexan-1-amine |
| SMILES | CCCNC1CCCC(C2CCCc3cccnc32)C1 |
| InChI | InChI=1S/C18H28N2/c1-2-11-19-16-9-3-7-15(13-16)17-10-4-6-14-8-5-12-20-18(14)17/h5,8,12,15-17,19H,2-4,6-7,9-11,13H2,1H3 |
| InChIKey | MPEOATHMBGVFRX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |