C17H30N2 — CID 79738785
N-ethyl-6-(5-ethyl-2-pyridinyl)-2,2-dimethylhexan-3-amine (PubChem CID 79738785) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N-ethyl-6-(5-ethyl-2-pyridinyl)-2,2-dimethylhexan-3-amine.
| Compound Name | N-ethyl-6-(5-ethyl-2-pyridinyl)-2,2-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 79738785 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-ethyl-6-(5-ethyl-2-pyridinyl)-2,2-dimethylhexan-3-amine |
| SMILES | CCNC(CCCc1ccc(CC)cn1)C(C)(C)C |
| InChI | InChI=1S/C17H30N2/c1-6-14-11-12-15(19-13-14)9-8-10-16(18-7-2)17(3,4)5/h11-13,16,18H,6-10H2,1-5H3 |
| InChIKey | PCPOZOBBGFGUCH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |