C12H16BrClN2 — CID 79741139
4-N-(5-bromo-2-chlorophenyl)cyclohexane-1,4-diamine (PubChem CID 79741139) has the molecular formula C12H16BrClN2 and a molecular weight of 303.63 g/mol. Its IUPAC name is 4-N-(5-bromo-2-chlorophenyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(5-bromo-2-chlorophenyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79741139 |
| Molecular Formula | C12H16BrClN2 |
| Molecular Weight | 303.63 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-N-(5-bromo-2-chlorophenyl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2cc(Br)ccc2Cl)CC1 |
| InChI | InChI=1S/C12H16BrClN2/c13-8-1-6-11(14)12(7-8)16-10-4-2-9(15)3-5-10/h1,6-7,9-10,16H,2-5,15H2 |
| InChIKey | CBPYJNDRFOXOFJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |