C17H19BrN2 — CID 79741538
1-N-[(4-bromophenyl)methyl]-1-N-methyl-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79741538) has the molecular formula C17H19BrN2 and a molecular weight of 331.26 g/mol. Its IUPAC name is 1-N-[(4-bromophenyl)methyl]-1-N-methyl-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-[(4-bromophenyl)methyl]-1-N-methyl-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79741538 |
| Molecular Formula | C17H19BrN2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1-N-[(4-bromophenyl)methyl]-1-N-methyl-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | CN(Cc1ccc(Br)cc1)C1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C17H19BrN2/c1-20(11-12-2-5-14(18)6-3-12)17-9-4-13-10-15(19)7-8-16(13)17/h2-3,5-8,10,17H,4,9,11,19H2,1H3 |
| InChIKey | AWGPEVOWOMUJFN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|