About N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine (PubChem CID 79741576) has the molecular formula C12H18N2S
and a molecular weight of 222.36 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine |
| PubChem CID | 79741576 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine |
| SMILES | c1c(CNC2CCNC2)sc2c1CCC2 |
| InChI | InChI=1S/C12H18N2S/c1-2-9-6-11(15-12(9)3-1)8-14-10-4-5-13-7-10/h6,10,13-14H,1-5,7-8H2 |
| InChIKey | CDJCEMMBGNYZMO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine?
The IUPAC name of N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine (CID 79741576) is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine.
What is the SMILES notation for N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine?
The canonical SMILES for N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine is c1c(CNC2CCNC2)sc2c1CCC2.
What is the InChIKey of N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine?
The InChIKey is CDJCEMMBGNYZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2S/c1-2-9-6-11(15-12(9)3-1)8-14-10-4-5-13-7-10/h6,10,13-14H,1-5,7-8H2.
What are the key properties of N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine?
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine has a molecular weight of 222.36 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrrolidin-3-amine is sourced from PubChem (CID 79741576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).