About 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine
4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine (PubChem CID 79741971) has the molecular formula C14H24N2S
and a molecular weight of 252.43 g/mol. Its IUPAC name is 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine |
| PubChem CID | 79741971 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine |
| SMILES | Cc1ccc(CC(C)NC2CCC(N)CC2)s1 |
| InChI | InChI=1S/C14H24N2S/c1-10(9-14-8-3-11(2)17-14)16-13-6-4-12(15)5-7-13/h3,8,10,12-13,16H,4-7,9,15H2,1-2H3 |
| InChIKey | ZDGWWSLDZDUGQZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine?
The IUPAC name of 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine (CID 79741971) is 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine.
What is the SMILES notation for 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine?
The canonical SMILES for 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine is Cc1ccc(CC(C)NC2CCC(N)CC2)s1.
What is the InChIKey of 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine?
The InChIKey is ZDGWWSLDZDUGQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2S/c1-10(9-14-8-3-11(2)17-14)16-13-6-4-12(15)5-7-13/h3,8,10,12-13,16H,4-7,9,15H2,1-2H3.
What are the key properties of 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine?
4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine has a molecular weight of 252.43 g/mol, XLogP of 2.85, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclohexane-1,4-diamine is sourced from PubChem (CID 79741971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).