C16H24N2O — CID 79741988
2-[1-(5-amino-2,3-dihydro-1H-inden-1-yl)piperidin-2-yl]ethanol (PubChem CID 79741988) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-[1-(5-amino-2,3-dihydro-1H-inden-1-yl)piperidin-2-yl]ethanol.
| Compound Name | 2-[1-(5-amino-2,3-dihydro-1H-inden-1-yl)piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 79741988 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-[1-(5-amino-2,3-dihydro-1H-inden-1-yl)piperidin-2-yl]ethanol |
| SMILES | Nc1ccc2c(c1)CCC2N1CCCCC1CCO |
| InChI | InChI=1S/C16H24N2O/c17-13-5-6-15-12(11-13)4-7-16(15)18-9-2-1-3-14(18)8-10-19/h5-6,11,14,16,19H,1-4,7-10,17H2 |
| InChIKey | CPQTVHZCNFKHCH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|