About 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine
4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine (PubChem CID 79742433) has the molecular formula C12H9BrClFN2
and a molecular weight of 315.57 g/mol. Its IUPAC name is 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine.
Molecular Properties
| Compound Name | 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine |
| PubChem CID | 79742433 |
| Molecular Formula | C12H9BrClFN2 |
| Molecular Weight | 315.57 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine |
| SMILES | Cc1nc(Cl)c(C)c(-c2cc(Br)ccc2F)n1 |
| InChI | InChI=1S/C12H9BrClFN2/c1-6-11(16-7(2)17-12(6)14)9-5-8(13)3-4-10(9)15/h3-5H,1-2H3 |
| InChIKey | HVKILQPICXSYKM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine?
The IUPAC name of 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine (CID 79742433) is 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine.
What is the SMILES notation for 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine?
The canonical SMILES for 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine is Cc1nc(Cl)c(C)c(-c2cc(Br)ccc2F)n1.
What is the InChIKey of 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine?
The InChIKey is HVKILQPICXSYKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrClFN2/c1-6-11(16-7(2)17-12(6)14)9-5-8(13)3-4-10(9)15/h3-5H,1-2H3.
What are the key properties of 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine?
4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine has a molecular weight of 315.57 g/mol, XLogP of 4.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-2-fluorophenyl)-6-chloro-2,5-dimethylpyrimidine is sourced from PubChem (CID 79742433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).