About 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine
4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 79743243) has the molecular formula C12H8BrFN6
and a molecular weight of 335.14 g/mol. Its IUPAC name is 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine |
| PubChem CID | 79743243 |
| Molecular Formula | C12H8BrFN6 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2cc(Br)ccc2F)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C12H8BrFN6/c13-7-1-2-9(14)8(5-7)10-17-11(15)19-12(18-10)20-4-3-16-6-20/h1-6H,(H2,15,17,18,19) |
| InChIKey | OBDPWBADUBEIRK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine?
The IUPAC name of 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine (CID 79743243) is 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine?
The canonical SMILES for 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine is Nc1nc(-c2cc(Br)ccc2F)nc(-n2ccnc2)n1.
What is the InChIKey of 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine?
The InChIKey is OBDPWBADUBEIRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrFN6/c13-7-1-2-9(14)8(5-7)10-17-11(15)19-12(18-10)20-4-3-16-6-20/h1-6H,(H2,15,17,18,19).
What are the key properties of 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine?
4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine has a molecular weight of 335.14 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-2-fluorophenyl)-6-imidazol-1-yl-1,3,5-triazin-2-amine is sourced from PubChem (CID 79743243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).