C11H16N4O — CID 79744158
2-(1-ethylimidazol-2-yl)-1-(3-methylimidazol-4-yl)ethanol (PubChem CID 79744158) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-(1-ethylimidazol-2-yl)-1-(3-methylimidazol-4-yl)ethanol.
| Compound Name | 2-(1-ethylimidazol-2-yl)-1-(3-methylimidazol-4-yl)ethanol |
|---|---|
| PubChem CID | 79744158 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-(1-ethylimidazol-2-yl)-1-(3-methylimidazol-4-yl)ethanol |
| SMILES | CCn1ccnc1CC(O)c1cncn1C |
| InChI | InChI=1S/C11H16N4O/c1-3-15-5-4-13-11(15)6-10(16)9-7-12-8-14(9)2/h4-5,7-8,10,16H,3,6H2,1-2H3 |
| InChIKey | VVEVHDMMTVHNIG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |