C17H31N3 — CID 79744341
2-tert-butyl-1-[(1-propylimidazol-2-yl)methyl]cyclohexan-1-amine (PubChem CID 79744341) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is 2-tert-butyl-1-[(1-propylimidazol-2-yl)methyl]cyclohexan-1-amine.
| Compound Name | 2-tert-butyl-1-[(1-propylimidazol-2-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 79744341 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | 2-tert-butyl-1-[(1-propylimidazol-2-yl)methyl]cyclohexan-1-amine |
| SMILES | CCCn1ccnc1CC1(N)CCCCC1C(C)(C)C |
| InChI | InChI=1S/C17H31N3/c1-5-11-20-12-10-19-15(20)13-17(18)9-7-6-8-14(17)16(2,3)4/h10,12,14H,5-9,11,13,18H2,1-4H3 |
| InChIKey | WWSCZRLWWAFJRQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |