About 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol
2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol (PubChem CID 797454) has the molecular formula C10H11ClNOS+
and a molecular weight of 228.72 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol |
| PubChem CID | 797454 |
| Molecular Formula | C10H11ClNOS+ |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol |
| SMILES | Cc1sc2ccc(Cl)cc2[n+]1CCO |
| InChI | InChI=1S/C10H11ClNOS/c1-7-12(4-5-13)9-6-8(11)2-3-10(9)14-7/h2-3,6,13H,4-5H2,1H3/q+1 |
| InChIKey | DVSYFLVRCZLNKU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol?
The IUPAC name of 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol (CID 797454) is 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol.
What is the SMILES notation for 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol?
The canonical SMILES for 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol is Cc1sc2ccc(Cl)cc2[n+]1CCO.
What is the InChIKey of 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol?
The InChIKey is DVSYFLVRCZLNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClNOS/c1-7-12(4-5-13)9-6-8(11)2-3-10(9)14-7/h2-3,6,13H,4-5H2,1H3/q+1.
What are the key properties of 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol?
2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol has a molecular weight of 228.72 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)ethanol is sourced from PubChem (CID 797454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).