C15H24FN — CID 79747552
N,2-diethyl-1-(4-fluoro-3-methylphenyl)butan-1-amine (PubChem CID 79747552) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is N,2-diethyl-1-(4-fluoro-3-methylphenyl)butan-1-amine.
| Compound Name | N,2-diethyl-1-(4-fluoro-3-methylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 79747552 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | N,2-diethyl-1-(4-fluoro-3-methylphenyl)butan-1-amine |
| SMILES | CCNC(c1ccc(F)c(C)c1)C(CC)CC |
| InChI | InChI=1S/C15H24FN/c1-5-12(6-2)15(17-7-3)13-8-9-14(16)11(4)10-13/h8-10,12,15,17H,5-7H2,1-4H3 |
| InChIKey | FQYYMINLXAKKIJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |