C13H8F3N3O — CID 79749034
5-methoxy-2-(2,3,4-trifluorophenyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 79749034) has the molecular formula C13H8F3N3O and a molecular weight of 279.22 g/mol. Its IUPAC name is 5-methoxy-2-(2,3,4-trifluorophenyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-methoxy-2-(2,3,4-trifluorophenyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79749034 |
| Molecular Formula | C13H8F3N3O |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5-methoxy-2-(2,3,4-trifluorophenyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1ccc2[nH]c(-c3ccc(F)c(F)c3F)nc2n1 |
| InChI | InChI=1S/C13H8F3N3O/c1-20-9-5-4-8-13(18-9)19-12(17-8)6-2-3-7(14)11(16)10(6)15/h2-5H,1H3,(H,17,18,19) |
| InChIKey | DLUMTGMLCLHXHU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|