C12H12F3NO3 — CID 79749423
2-[[(2,3,4-trifluorobenzoyl)amino]methyl]butanoic acid (PubChem CID 79749423) has the molecular formula C12H12F3NO3 and a molecular weight of 275.23 g/mol. Its IUPAC name is 2-[[(2,3,4-trifluorobenzoyl)amino]methyl]butanoic acid.
| Compound Name | 2-[[(2,3,4-trifluorobenzoyl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 79749423 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[[(2,3,4-trifluorobenzoyl)amino]methyl]butanoic acid |
| SMILES | CCC(CNC(=O)c1ccc(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C12H12F3NO3/c1-2-6(12(18)19)5-16-11(17)7-3-4-8(13)10(15)9(7)14/h3-4,6H,2,5H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | APZTWYUAOBSKGN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|