C11H7F3N2O4 — CID 79749471
2-[[5-(2,3,4-trifluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]acetic acid (PubChem CID 79749471) has the molecular formula C11H7F3N2O4 and a molecular weight of 288.18 g/mol. Its IUPAC name is 2-[[5-(2,3,4-trifluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]acetic acid.
| Compound Name | 2-[[5-(2,3,4-trifluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 79749471 |
| Molecular Formula | C11H7F3N2O4 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[[5-(2,3,4-trifluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]acetic acid |
| SMILES | O=C(O)COCc1nnc(-c2ccc(F)c(F)c2F)o1 |
| InChI | InChI=1S/C11H7F3N2O4/c12-6-2-1-5(9(13)10(6)14)11-16-15-7(20-11)3-19-4-8(17)18/h1-2H,3-4H2,(H,17,18) |
| InChIKey | OOWXHLMFIPGJEI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|