C14H13ClN4 — CID 79750643
5-chloro-3-[(1-methylbenzimidazol-2-yl)methyl]pyridin-2-amine (PubChem CID 79750643) has the molecular formula C14H13ClN4 and a molecular weight of 272.74 g/mol. Its IUPAC name is 5-chloro-3-[(1-methylbenzimidazol-2-yl)methyl]pyridin-2-amine.
| Compound Name | 5-chloro-3-[(1-methylbenzimidazol-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 79750643 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-chloro-3-[(1-methylbenzimidazol-2-yl)methyl]pyridin-2-amine |
| SMILES | Cn1c(Cc2cc(Cl)cnc2N)nc2ccccc21 |
| InChI | InChI=1S/C14H13ClN4/c1-19-12-5-3-2-4-11(12)18-13(19)7-9-6-10(15)8-17-14(9)16/h2-6,8H,7H2,1H3,(H2,16,17) |
| InChIKey | AANAPNBJYIFXFN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |