C9H15NO4 — CID 79750680
2-[methyl-(2-methyloxolane-3-carbonyl)amino]acetic acid (PubChem CID 79750680) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-[methyl-(2-methyloxolane-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[methyl-(2-methyloxolane-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 79750680 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-[methyl-(2-methyloxolane-3-carbonyl)amino]acetic acid |
| SMILES | CC1OCCC1C(=O)N(C)CC(=O)O |
| InChI | InChI=1S/C9H15NO4/c1-6-7(3-4-14-6)9(13)10(2)5-8(11)12/h6-7H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | LQADHAIJWMXOLM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |