C11H17NO4 — CID 79750690
1-(2-methyloxolane-3-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 79750690) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-(2-methyloxolane-3-carbonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-methyloxolane-3-carbonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 79750690 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-(2-methyloxolane-3-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC1OCCC1C(=O)N1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C11H17NO4/c1-7-9(3-5-16-7)10(13)12-4-2-8(6-12)11(14)15/h7-9H,2-6H2,1H3,(H,14,15) |
| InChIKey | HKYLYEZKFZCNIA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |