C14H16N2O — CID 79750868
2-[(1-methylbenzimidazol-2-yl)methyl]cyclopentan-1-one (PubChem CID 79750868) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-[(1-methylbenzimidazol-2-yl)methyl]cyclopentan-1-one.
| Compound Name | 2-[(1-methylbenzimidazol-2-yl)methyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 79750868 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-[(1-methylbenzimidazol-2-yl)methyl]cyclopentan-1-one |
| SMILES | Cn1c(CC2CCCC2=O)nc2ccccc21 |
| InChI | InChI=1S/C14H16N2O/c1-16-12-7-3-2-6-11(12)15-14(16)9-10-5-4-8-13(10)17/h2-3,6-7,10H,4-5,8-9H2,1H3 |
| InChIKey | HKNZNJYTWSUWFN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |