C15H18F3N3 — CID 79751877
N-ethyl-2-(1-ethylimidazol-2-yl)-1-(3,4,5-trifluorophenyl)ethanamine (PubChem CID 79751877) has the molecular formula C15H18F3N3 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-ethyl-2-(1-ethylimidazol-2-yl)-1-(3,4,5-trifluorophenyl)ethanamine.
| Compound Name | N-ethyl-2-(1-ethylimidazol-2-yl)-1-(3,4,5-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 79751877 |
| Molecular Formula | C15H18F3N3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-ethyl-2-(1-ethylimidazol-2-yl)-1-(3,4,5-trifluorophenyl)ethanamine |
| SMILES | CCNC(Cc1nccn1CC)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H18F3N3/c1-3-19-13(9-14-20-5-6-21(14)4-2)10-7-11(16)15(18)12(17)8-10/h5-8,13,19H,3-4,9H2,1-2H3 |
| InChIKey | BZHKROSFBFTDIF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|