C17H25N3S — CID 79752662
N-ethyl-1-(1-ethylimidazol-2-yl)-3-(3-methylphenyl)sulfanylpropan-2-amine (PubChem CID 79752662) has the molecular formula C17H25N3S and a molecular weight of 303.48 g/mol. Its IUPAC name is N-ethyl-1-(1-ethylimidazol-2-yl)-3-(3-methylphenyl)sulfanylpropan-2-amine.
| Compound Name | N-ethyl-1-(1-ethylimidazol-2-yl)-3-(3-methylphenyl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 79752662 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-ethyl-1-(1-ethylimidazol-2-yl)-3-(3-methylphenyl)sulfanylpropan-2-amine |
| SMILES | CCNC(CSc1cccc(C)c1)Cc1nccn1CC |
| InChI | InChI=1S/C17H25N3S/c1-4-18-15(12-17-19-9-10-20(17)5-2)13-21-16-8-6-7-14(3)11-16/h6-11,15,18H,4-5,12-13H2,1-3H3 |
| InChIKey | HNIDQOKUJLEZCU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |