C10H11BrN2OS — CID 79752976
1-(4-bromothiophen-2-yl)-2-(1-methylimidazol-2-yl)ethanol (PubChem CID 79752976) has the molecular formula C10H11BrN2OS and a molecular weight of 287.18 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-2-(1-methylimidazol-2-yl)ethanol.
| Compound Name | 1-(4-bromothiophen-2-yl)-2-(1-methylimidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 79752976 |
| Molecular Formula | C10H11BrN2OS |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-2-(1-methylimidazol-2-yl)ethanol |
| SMILES | Cn1ccnc1CC(O)c1cc(Br)cs1 |
| InChI | InChI=1S/C10H11BrN2OS/c1-13-3-2-12-10(13)5-8(14)9-4-7(11)6-15-9/h2-4,6,8,14H,5H2,1H3 |
| InChIKey | OIVWQDZFTUYCCK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |