About 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione
3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione (PubChem CID 79755635) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione.
Molecular Properties
| Compound Name | 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione |
| PubChem CID | 79755635 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione |
| SMILES | Cc1ccccc1CCN1C(=O)C(C)NC(=O)C1C |
| InChI | InChI=1S/C15H20N2O2/c1-10-6-4-5-7-13(10)8-9-17-12(3)14(18)16-11(2)15(17)19/h4-7,11-12H,8-9H2,1-3H3,(H,16,18) |
| InChIKey | CPKZIQRQAFOLHX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione?
The IUPAC name of 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione (CID 79755635) is 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione.
What is the SMILES notation for 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione?
The canonical SMILES for 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione is Cc1ccccc1CCN1C(=O)C(C)NC(=O)C1C.
What is the InChIKey of 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione?
The InChIKey is CPKZIQRQAFOLHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-10-6-4-5-7-13(10)8-9-17-12(3)14(18)16-11(2)15(17)19/h4-7,11-12H,8-9H2,1-3H3,(H,16,18).
What are the key properties of 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione?
3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione has a molecular weight of 260.34 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-1-[2-(2-methylphenyl)ethyl]piperazine-2,5-dione is sourced from PubChem (CID 79755635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).