About 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine
3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine (PubChem CID 7975580) has the molecular formula C18H22FN3OS
and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine |
| PubChem CID | 7975580 |
| Molecular Formula | C18H22FN3OS |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine |
| SMILES | COCC/N=c1\scc(-c2ccc(F)cc2)n1N=C1CCCCC1 |
| InChI | InChI=1S/C18H22FN3OS/c1-23-12-11-20-18-22(21-16-5-3-2-4-6-16)17(13-24-18)14-7-9-15(19)10-8-14/h7-10,13H,2-6,11-12H2,1H3/b20-18- |
| InChIKey | JGJGSMXDFBGCAJ-ZZEZOPTASA-N |
| XLogP | 4.07 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine?
The IUPAC name of 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine (CID 7975580) is 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine.
What is the SMILES notation for 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine?
The canonical SMILES for 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine is COCC/N=c1\scc(-c2ccc(F)cc2)n1N=C1CCCCC1.
What is the InChIKey of 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine?
The InChIKey is JGJGSMXDFBGCAJ-ZZEZOPTASA-N. The full InChI is InChI=1S/C18H22FN3OS/c1-23-12-11-20-18-22(21-16-5-3-2-4-6-16)17(13-24-18)14-7-9-15(19)10-8-14/h7-10,13H,2-6,11-12H2,1H3/b20-18-.
What are the key properties of 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine?
3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine has a molecular weight of 347.46 g/mol, XLogP of 4.07, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexylideneamino)-4-(4-fluorophenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine is sourced from PubChem (CID 7975580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).