C13H12F2N4O2 — CID 79755846
2-(2,6-difluoro-3-nitrophenyl)-6-propan-2-ylpyrimidin-4-amine (PubChem CID 79755846) has the molecular formula C13H12F2N4O2 and a molecular weight of 294.26 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-nitrophenyl)-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-(2,6-difluoro-3-nitrophenyl)-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79755846 |
| Molecular Formula | C13H12F2N4O2 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(2,6-difluoro-3-nitrophenyl)-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1cc(N)nc(-c2c(F)ccc([N+](=O)[O-])c2F)n1 |
| InChI | InChI=1S/C13H12F2N4O2/c1-6(2)8-5-10(16)18-13(17-8)11-7(14)3-4-9(12(11)15)19(20)21/h3-6H,1-2H3,(H2,16,17,18) |
| InChIKey | PIHAFTWQOQFAFT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|