About 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one
3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one (PubChem CID 797561) has the molecular formula C18H14N2O2S
and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one.
Molecular Properties
| Compound Name | 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one |
| PubChem CID | 797561 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one |
| SMILES | Nc1c(C(=O)c2ccccc2)sc2nc3c(cc12)C(=O)CCC3 |
| InChI | InChI=1S/C18H14N2O2S/c19-15-12-9-11-13(7-4-8-14(11)21)20-18(12)23-17(15)16(22)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8,19H2 |
| InChIKey | QBCIDOFNASELCM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one?
The IUPAC name of 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one (CID 797561) is 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one.
What is the SMILES notation for 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one?
The canonical SMILES for 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one is Nc1c(C(=O)c2ccccc2)sc2nc3c(cc12)C(=O)CCC3.
What is the InChIKey of 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one?
The InChIKey is QBCIDOFNASELCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O2S/c19-15-12-9-11-13(7-4-8-14(11)21)20-18(12)23-17(15)16(22)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8,19H2.
What are the key properties of 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one?
3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one has a molecular weight of 322.39 g/mol, XLogP of 3.63, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-benzoyl-7,8-dihydro-6H-thieno[2,3-b]quinolin-5-one is sourced from PubChem (CID 797561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).