C12H12F3N3S — CID 79756401
N-[[5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine (PubChem CID 79756401) has the molecular formula C12H12F3N3S and a molecular weight of 287.31 g/mol. Its IUPAC name is N-[[5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 79756401 |
| Molecular Formula | C12H12F3N3S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-[[5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1nnc(-c2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C12H12F3N3S/c1-6(2)16-5-9-17-18-12(19-9)7-3-4-8(13)11(15)10(7)14/h3-4,6,16H,5H2,1-2H3 |
| InChIKey | HDYMOJATIVWYOH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|