C12H10F3N3S — CID 79756560
N-[[5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine (PubChem CID 79756560) has the molecular formula C12H10F3N3S and a molecular weight of 285.29 g/mol. Its IUPAC name is N-[[5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 79756560 |
| Molecular Formula | C12H10F3N3S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-[[5-(2,3,4-trifluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(-c2nnc(CNC3CC3)s2)c(F)c1F |
| InChI | InChI=1S/C12H10F3N3S/c13-8-4-3-7(10(14)11(8)15)12-18-17-9(19-12)5-16-6-1-2-6/h3-4,6,16H,1-2,5H2 |
| InChIKey | AZDGNTIYVKHPAA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|