C14H9Cl2F3O — CID 79756898
1-[chloro-(3-chloro-4-methoxyphenyl)methyl]-2,3,4-trifluorobenzene (PubChem CID 79756898) has the molecular formula C14H9Cl2F3O and a molecular weight of 321.13 g/mol. Its IUPAC name is 1-[chloro-(3-chloro-4-methoxyphenyl)methyl]-2,3,4-trifluorobenzene.
| Compound Name | 1-[chloro-(3-chloro-4-methoxyphenyl)methyl]-2,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 79756898 |
| Molecular Formula | C14H9Cl2F3O |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 1-[chloro-(3-chloro-4-methoxyphenyl)methyl]-2,3,4-trifluorobenzene |
| SMILES | COc1ccc(C(Cl)c2ccc(F)c(F)c2F)cc1Cl |
| InChI | InChI=1S/C14H9Cl2F3O/c1-20-11-5-2-7(6-9(11)15)12(16)8-3-4-10(17)14(19)13(8)18/h2-6,12H,1H3 |
| InChIKey | DIJJPRUKQCBITL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|