C17H16ClF3 — CID 79756900
1-[(4-butylphenyl)-chloromethyl]-2,3,4-trifluorobenzene (PubChem CID 79756900) has the molecular formula C17H16ClF3 and a molecular weight of 312.76 g/mol. Its IUPAC name is 1-[(4-butylphenyl)-chloromethyl]-2,3,4-trifluorobenzene.
| Compound Name | 1-[(4-butylphenyl)-chloromethyl]-2,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 79756900 |
| Molecular Formula | C17H16ClF3 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-[(4-butylphenyl)-chloromethyl]-2,3,4-trifluorobenzene |
| SMILES | CCCCc1ccc(C(Cl)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H16ClF3/c1-2-3-4-11-5-7-12(8-6-11)15(18)13-9-10-14(19)17(21)16(13)20/h5-10,15H,2-4H2,1H3 |
| InChIKey | QBDUVZUAFIYYSV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|