About 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine
3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine (PubChem CID 79757194) has the molecular formula C17H28N4
and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine.
Molecular Properties
| Compound Name | 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine |
| PubChem CID | 79757194 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine |
| SMILES | CCC(CC)(C(N)Cc1nc2ccccc2n1C)N(C)C |
| InChI | InChI=1S/C17H28N4/c1-6-17(7-2,20(3)4)15(18)12-16-19-13-10-8-9-11-14(13)21(16)5/h8-11,15H,6-7,12,18H2,1-5H3 |
| InChIKey | KLHXWOZKCJRSKJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine?
The IUPAC name of 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine (CID 79757194) is 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine.
What is the SMILES notation for 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine?
The canonical SMILES for 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine is CCC(CC)(C(N)Cc1nc2ccccc2n1C)N(C)C.
What is the InChIKey of 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine?
The InChIKey is KLHXWOZKCJRSKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4/c1-6-17(7-2,20(3)4)15(18)12-16-19-13-10-8-9-11-14(13)21(16)5/h8-11,15H,6-7,12,18H2,1-5H3.
What are the key properties of 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine?
3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine has a molecular weight of 288.44 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-N,3-N-dimethyl-1-(1-methylbenzimidazol-2-yl)pentane-2,3-diamine is sourced from PubChem (CID 79757194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).