C10H6F2N4O4S — CID 79757966
2-[[5-(2,6-difluoro-3-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 79757966) has the molecular formula C10H6F2N4O4S and a molecular weight of 316.25 g/mol. Its IUPAC name is 2-[[5-(2,6-difluoro-3-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-(2,6-difluoro-3-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 79757966 |
| Molecular Formula | C10H6F2N4O4S |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-[[5-(2,6-difluoro-3-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1n[nH]c(-c2c(F)ccc([N+](=O)[O-])c2F)n1 |
| InChI | InChI=1S/C10H6F2N4O4S/c11-4-1-2-5(16(19)20)8(12)7(4)9-13-10(15-14-9)21-3-6(17)18/h1-2H,3H2,(H,17,18)(H,13,14,15) |
| InChIKey | GFIMAAGYCPAHFI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|