C8H15NO2 — CID 79758522
N-ethyl-2-methyloxolane-3-carboxamide (PubChem CID 79758522) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is N-ethyl-2-methyloxolane-3-carboxamide.
| Compound Name | N-ethyl-2-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 79758522 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N-ethyl-2-methyloxolane-3-carboxamide |
| SMILES | CCNC(=O)C1CCOC1C |
| InChI | InChI=1S/C8H15NO2/c1-3-9-8(10)7-4-5-11-6(7)2/h6-7H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | LBHYITWRLDFRER-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |