C12H13ClFNO4S — CID 79759048
2-fluoro-4-[(2-methyloxolane-3-carbonyl)amino]benzenesulfonyl chloride (PubChem CID 79759048) has the molecular formula C12H13ClFNO4S and a molecular weight of 321.76 g/mol. Its IUPAC name is 2-fluoro-4-[(2-methyloxolane-3-carbonyl)amino]benzenesulfonyl chloride.
| Compound Name | 2-fluoro-4-[(2-methyloxolane-3-carbonyl)amino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 79759048 |
| Molecular Formula | C12H13ClFNO4S |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-fluoro-4-[(2-methyloxolane-3-carbonyl)amino]benzenesulfonyl chloride |
| SMILES | CC1OCCC1C(=O)Nc1ccc(S(=O)(=O)Cl)c(F)c1 |
| InChI | InChI=1S/C12H13ClFNO4S/c1-7-9(4-5-19-7)12(16)15-8-2-3-11(10(14)6-8)20(13,17)18/h2-3,6-7,9H,4-5H2,1H3,(H,15,16) |
| InChIKey | UETLFHMKYDIDNW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |