About 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine
5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 79760347) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine |
| PubChem CID | 79760347 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC1OCCC1c1nnc(N)o1 |
| InChI | InChI=1S/C7H11N3O2/c1-4-5(2-3-11-4)6-9-10-7(8)12-6/h4-5H,2-3H2,1H3,(H2,8,10) |
| InChIKey | AQYVMPSGELPCND-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine (CID 79760347) is 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine is CC1OCCC1c1nnc(N)o1.
What is the InChIKey of 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine?
The InChIKey is AQYVMPSGELPCND-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-4-5(2-3-11-4)6-9-10-7(8)12-6/h4-5H,2-3H2,1H3,(H2,8,10).
What are the key properties of 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine?
5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine has a molecular weight of 169.18 g/mol, XLogP of 0.54, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyloxolan-3-yl)-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 79760347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).