C11H13N5O4S — CID 79760655
5-nitro-1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidine-2,4-dione (PubChem CID 79760655) has the molecular formula C11H13N5O4S and a molecular weight of 311.32 g/mol. Its IUPAC name is 5-nitro-1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidine-2,4-dione.
| Compound Name | 5-nitro-1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79760655 |
| Molecular Formula | C11H13N5O4S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 5-nitro-1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidine-2,4-dione |
| SMILES | CCCNc1ncc(Cn2cc([N+](=O)[O-])c(=O)[nH]c2=O)s1 |
| InChI | InChI=1S/C11H13N5O4S/c1-2-3-12-10-13-4-7(21-10)5-15-6-8(16(19)20)9(17)14-11(15)18/h4,6H,2-3,5H2,1H3,(H,12,13)(H,14,17,18) |
| InChIKey | IRTRQMVKYQGZIW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 122.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|