About 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione
3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione (PubChem CID 79760657) has the molecular formula C11H13N5O4S
and a molecular weight of 311.32 g/mol. Its IUPAC name is 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione |
| PubChem CID | 79760657 |
| Molecular Formula | C11H13N5O4S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1cc([N+](=O)[O-])c(=O)n(Cc2cnc(N)s2)c1=O |
| InChI | InChI=1S/C11H13N5O4S/c1-2-3-14-6-8(16(19)20)9(17)15(11(14)18)5-7-4-13-10(12)21-7/h4,6H,2-3,5H2,1H3,(H2,12,13) |
| InChIKey | WWNAGYDJEHWFMI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione?
The IUPAC name of 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione (CID 79760657) is 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione.
What is the SMILES notation for 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione?
The canonical SMILES for 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione is CCCn1cc([N+](=O)[O-])c(=O)n(Cc2cnc(N)s2)c1=O.
What is the InChIKey of 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione?
The InChIKey is WWNAGYDJEHWFMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O4S/c1-2-3-14-6-8(16(19)20)9(17)15(11(14)18)5-7-4-13-10(12)21-7/h4,6H,2-3,5H2,1H3,(H2,12,13).
What are the key properties of 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione?
3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione has a molecular weight of 311.32 g/mol, XLogP of 0.42, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitro-1-propylpyrimidine-2,4-dione is sourced from PubChem (CID 79760657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).