C14H16FIN2O3 — CID 79760864
2-[1-[(4-fluoro-2-iodophenyl)carbamoyl]piperidin-2-yl]acetic acid (PubChem CID 79760864) has the molecular formula C14H16FIN2O3 and a molecular weight of 406.20 g/mol. Its IUPAC name is 2-[1-[(4-fluoro-2-iodophenyl)carbamoyl]piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-[(4-fluoro-2-iodophenyl)carbamoyl]piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 79760864 |
| Molecular Formula | C14H16FIN2O3 |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 2-[1-[(4-fluoro-2-iodophenyl)carbamoyl]piperidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCCN1C(=O)Nc1ccc(F)cc1I |
| InChI | InChI=1S/C14H16FIN2O3/c15-9-4-5-12(11(16)7-9)17-14(21)18-6-2-1-3-10(18)8-13(19)20/h4-5,7,10H,1-3,6,8H2,(H,17,21)(H,19,20) |
| InChIKey | PDRXLPURDZFXTN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|