C15H27N3 — CID 79761258
2-(1-methylimidazol-2-yl)-1-(4-propylcyclohexyl)ethanamine (PubChem CID 79761258) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-1-(4-propylcyclohexyl)ethanamine.
| Compound Name | 2-(1-methylimidazol-2-yl)-1-(4-propylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 79761258 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-1-(4-propylcyclohexyl)ethanamine |
| SMILES | CCCC1CCC(C(N)Cc2nccn2C)CC1 |
| InChI | InChI=1S/C15H27N3/c1-3-4-12-5-7-13(8-6-12)14(16)11-15-17-9-10-18(15)2/h9-10,12-14H,3-8,11,16H2,1-2H3 |
| InChIKey | SJNOXKCYTOMASH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |