C17H20FIN2 — CID 79761506
2-fluoro-4-iodo-N-propyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine (PubChem CID 79761506) has the molecular formula C17H20FIN2 and a molecular weight of 398.26 g/mol. Its IUPAC name is 2-fluoro-4-iodo-N-propyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine.
| Compound Name | 2-fluoro-4-iodo-N-propyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine |
|---|---|
| PubChem CID | 79761506 |
| Molecular Formula | C17H20FIN2 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-fluoro-4-iodo-N-propyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine |
| SMILES | CCCNc1c2c(nc3c(I)cc(F)cc13)CCCCC2 |
| InChI | InChI=1S/C17H20FIN2/c1-2-8-20-16-12-6-4-3-5-7-15(12)21-17-13(16)9-11(18)10-14(17)19/h9-10H,2-8H2,1H3,(H,20,21) |
| InChIKey | LZPIAVOOHZSWSU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|