C13H23BrN2 — CID 79762064
2-(4-bromo-2,2-dimethylpentyl)-1-propylimidazole (PubChem CID 79762064) has the molecular formula C13H23BrN2 and a molecular weight of 287.25 g/mol. Its IUPAC name is 2-(4-bromo-2,2-dimethylpentyl)-1-propylimidazole.
| Compound Name | 2-(4-bromo-2,2-dimethylpentyl)-1-propylimidazole |
|---|---|
| PubChem CID | 79762064 |
| Molecular Formula | C13H23BrN2 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-(4-bromo-2,2-dimethylpentyl)-1-propylimidazole |
| SMILES | CCCn1ccnc1CC(C)(C)CC(C)Br |
| InChI | InChI=1S/C13H23BrN2/c1-5-7-16-8-6-15-12(16)10-13(3,4)9-11(2)14/h6,8,11H,5,7,9-10H2,1-4H3 |
| InChIKey | BRQVKTFSRKVGGN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|