C17H23ClN2O2 — CID 7976258
2-chloro-N-[3-[[(1R,2R)-2-methylcyclohexyl]amino]-3-oxopropyl]benzamide (PubChem CID 7976258) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-chloro-N-[3-[[(1R,2R)-2-methylcyclohexyl]amino]-3-oxopropyl]benzamide.
| Compound Name | 2-chloro-N-[3-[[(1R,2R)-2-methylcyclohexyl]amino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 7976258 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-chloro-N-[3-[[(1R,2R)-2-methylcyclohexyl]amino]-3-oxopropyl]benzamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)CCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H23ClN2O2/c1-12-6-2-5-9-15(12)20-16(21)10-11-19-17(22)13-7-3-4-8-14(13)18/h3-4,7-8,12,15H,2,5-6,9-11H2,1H3,(H,19,22)(H,20,21)/t12-,15-/m1/s1 |
| InChIKey | QUCKVVHRXSAMMN-IUODEOHRSA-N |
| XLogP | 3.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |