About 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane
3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane (PubChem CID 79762752) has the molecular formula C15H21BrO
and a molecular weight of 297.24 g/mol. Its IUPAC name is 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane.
Molecular Properties
| Compound Name | 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane |
| PubChem CID | 79762752 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane |
| SMILES | Cc1ccc(C)c(CC(Br)C2CCOC2C)c1 |
| InChI | InChI=1S/C15H21BrO/c1-10-4-5-11(2)13(8-10)9-15(16)14-6-7-17-12(14)3/h4-5,8,12,14-15H,6-7,9H2,1-3H3 |
| InChIKey | CUWPUCCKGAKJNS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane?
The IUPAC name of 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane (CID 79762752) is 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane.
What is the SMILES notation for 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane?
The canonical SMILES for 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane is Cc1ccc(C)c(CC(Br)C2CCOC2C)c1.
What is the InChIKey of 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane?
The InChIKey is CUWPUCCKGAKJNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrO/c1-10-4-5-11(2)13(8-10)9-15(16)14-6-7-17-12(14)3/h4-5,8,12,14-15H,6-7,9H2,1-3H3.
What are the key properties of 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane?
3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane has a molecular weight of 297.24 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2-methyloxolane is sourced from PubChem (CID 79762752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).