About [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine
[5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79763893) has the molecular formula C10H18N4S
and a molecular weight of 226.35 g/mol. Its IUPAC name is [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine.
Molecular Properties
| Compound Name | [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine |
| PubChem CID | 79763893 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | CC1(C)CCCN1Cc1cnc(NN)s1 |
| InChI | InChI=1S/C10H18N4S/c1-10(2)4-3-5-14(10)7-8-6-12-9(13-11)15-8/h6H,3-5,7,11H2,1-2H3,(H,12,13) |
| InChIKey | IAIWOUFBHZDOAQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine?
The IUPAC name of [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine (CID 79763893) is [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine.
What is the SMILES notation for [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine?
The canonical SMILES for [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine is CC1(C)CCCN1Cc1cnc(NN)s1.
What is the InChIKey of [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine?
The InChIKey is IAIWOUFBHZDOAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4S/c1-10(2)4-3-5-14(10)7-8-6-12-9(13-11)15-8/h6H,3-5,7,11H2,1-2H3,(H,12,13).
What are the key properties of [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine?
[5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine has a molecular weight of 226.35 g/mol, XLogP of 1.80, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2,2-dimethylpyrrolidin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine is sourced from PubChem (CID 79763893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).