C8H8N6O4S — CID 79763903
1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione (PubChem CID 79763903) has the molecular formula C8H8N6O4S and a molecular weight of 284.26 g/mol. Its IUPAC name is 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79763903 |
| Molecular Formula | C8H8N6O4S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione |
| SMILES | NNc1ncc(Cn2cc([N+](=O)[O-])c(=O)[nH]c2=O)s1 |
| InChI | InChI=1S/C8H8N6O4S/c9-12-7-10-1-4(19-7)2-13-3-5(14(17)18)6(15)11-8(13)16/h1,3H,2,9H2,(H,10,12)(H,11,15,16) |
| InChIKey | DAWYUFLTGWJASZ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 148.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|