C6H8N6S — CID 79764015
[5-(1,2,4-triazol-1-ylmethyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764015) has the molecular formula C6H8N6S and a molecular weight of 196.24 g/mol. Its IUPAC name is [5-(1,2,4-triazol-1-ylmethyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-(1,2,4-triazol-1-ylmethyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79764015 |
| Molecular Formula | C6H8N6S |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | [5-(1,2,4-triazol-1-ylmethyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1ncc(Cn2cncn2)s1 |
| InChI | InChI=1S/C6H8N6S/c7-11-6-9-1-5(13-6)2-12-4-8-3-10-12/h1,3-4H,2,7H2,(H,9,11) |
| InChIKey | OQJXRJMVAARQEY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|