About 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione
3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione (PubChem CID 79764021) has the molecular formula C9H10N6O4S
and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione |
| PubChem CID | 79764021 |
| Molecular Formula | C9H10N6O4S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione |
| SMILES | Cn1cc([N+](=O)[O-])c(=O)n(Cc2cnc(NN)s2)c1=O |
| InChI | InChI=1S/C9H10N6O4S/c1-13-4-6(15(18)19)7(16)14(9(13)17)3-5-2-11-8(12-10)20-5/h2,4H,3,10H2,1H3,(H,11,12) |
| InChIKey | JZWSDOSNUXPGCA-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione?
The IUPAC name of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione (CID 79764021) is 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione.
What is the SMILES notation for 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione?
The canonical SMILES for 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione is Cn1cc([N+](=O)[O-])c(=O)n(Cc2cnc(NN)s2)c1=O.
What is the InChIKey of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione?
The InChIKey is JZWSDOSNUXPGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N6O4S/c1-13-4-6(15(18)19)7(16)14(9(13)17)3-5-2-11-8(12-10)20-5/h2,4H,3,10H2,1H3,(H,11,12).
What are the key properties of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione?
3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione has a molecular weight of 298.28 g/mol, XLogP of -0.75, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione is sourced from PubChem (CID 79764021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).